Hydrothermal synthesis and structure of an open-framework vanadium-manganese phosphate [C₄H₁₂N₂]₂Mn^II(V^VO₂)₂(V_2^IVO₂)(PO₄)₄(H₂O)₄

Abstract

A 3-D vanadium-manganese phosphate, [C4H12N2]2MnII(VVO2)2(O2)(PO4)4(H2O)4 (1), was synthesized hydrothermally and characterized by single crystal X-ray diffraction. This complex crystallizes in the triclinic system with the space group P 1 and cell parameters a = 7.070(2) Å, b = 12.356(4) Å, c = 17.120(6) Å, α = 75.698(9)°, β = 85.651(12)°, γ = 78.331(10)°, and Z = 2. The 3-D vanadium-manganese phosphate formed from VIV octahedral chains and VV–MnII–VV clusters, which are linked via PO4 tetrahedra. Complex 1 contains channels in three directions in which diprotonated piperazine ions and water molecules reside. Characterization by element analysis, IR, XPS, fluorescence spectrum, and TG analysis are also described.